About 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate
2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate (PubChem CID 166440120) has the molecular formula C22H32O3
and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate |
| PubChem CID | 166440120 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate |
| SMILES | CC(=O)COC(=O)C(CC1CCCCC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32O3/c1-16(23)15-25-21(24)20(14-17-8-6-5-7-9-17)18-10-12-19(13-11-18)22(2,3)4/h10-13,17,20H,5-9,14-15H2,1-4H3 |
| InChIKey | XIQXXMNUCASFGO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate?
The IUPAC name of 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate (CID 166440120) is 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate.
What is the SMILES notation for 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate?
The canonical SMILES for 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate is CC(=O)COC(=O)C(CC1CCCCC1)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate?
The InChIKey is XIQXXMNUCASFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O3/c1-16(23)15-25-21(24)20(14-17-8-6-5-7-9-17)18-10-12-19(13-11-18)22(2,3)4/h10-13,17,20H,5-9,14-15H2,1-4H3.
What are the key properties of 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate?
2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate has a molecular weight of 344.50 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 2-(4-tert-butylphenyl)-3-cyclohexylpropanoate is sourced from PubChem (CID 166440120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).