C12H19NO2 — CID 166440192
(2E,4E)-1-morpholin-4-ylocta-2,4-dien-1-one (PubChem CID 166440192) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (2E,4E)-1-morpholin-4-ylocta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-morpholin-4-ylocta-2,4-dien-1-one |
|---|---|
| PubChem CID | 166440192 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (2E,4E)-1-morpholin-4-ylocta-2,4-dien-1-one |
| SMILES | CCC/C=C/C=C/C(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H19NO2/c1-2-3-4-5-6-7-12(14)13-8-10-15-11-9-13/h4-7H,2-3,8-11H2,1H3/b5-4+,7-6+ |
| InChIKey | KACIWXVXBWJXRV-YTXTXJHMSA-N |
| XLogP | 1.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|