C27H29FO4S — CID 166440351
[4-[(Z)-2-fluoro-5-(4-methoxyphenyl)-3,3-dimethylpent-1-enyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 166440351) has the molecular formula C27H29FO4S and a molecular weight of 468.59 g/mol. Its IUPAC name is [4-[(Z)-2-fluoro-5-(4-methoxyphenyl)-3,3-dimethylpent-1-enyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-2-fluoro-5-(4-methoxyphenyl)-3,3-dimethylpent-1-enyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 166440351 |
| Molecular Formula | C27H29FO4S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [4-[(Z)-2-fluoro-5-(4-methoxyphenyl)-3,3-dimethylpent-1-enyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CCC(C)(C)/C(F)=C/c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H29FO4S/c1-20-5-15-25(16-6-20)33(29,30)32-24-13-9-22(10-14-24)19-26(28)27(2,3)18-17-21-7-11-23(31-4)12-8-21/h5-16,19H,17-18H2,1-4H3/b26-19- |
| InChIKey | ZOFWYABEQITPKR-XHPQRKPJSA-N |
| XLogP | 6.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|