C20H18F3NO3S — CID 10645180
4-[5-[4-(trifluoromethoxy)phenyl]spiro[2.4]hept-5-en-6-yl]benzenesulfonamide (PubChem CID 10645180) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is 4-[5-[4-(trifluoromethoxy)phenyl]spiro[2.4]hept-5-en-6-yl]benzenesulfonamide.
| Compound Name | 4-[5-[4-(trifluoromethoxy)phenyl]spiro[2.4]hept-5-en-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10645180 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-[5-[4-(trifluoromethoxy)phenyl]spiro[2.4]hept-5-en-6-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(OC(F)(F)F)cc3)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C20H18F3NO3S/c21-20(22,23)27-15-5-1-13(2-6-15)17-11-19(9-10-19)12-18(17)14-3-7-16(8-4-14)28(24,25)26/h1-8H,9-12H2,(H2,24,25,26) |
| InChIKey | JFTYUKJRCTXQSJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|