C24H34O5 — CID 166440994
[(1R,2S,4S,7S,8R,9S,12S,13E,16S)-7,9,13-trimethyl-6,18-dioxo-5-oxatetracyclo[10.8.0.02,9.04,8]icos-13-en-16-yl] acetate (PubChem CID 166440994) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1R,2S,4S,7S,8R,9S,12S,13E,16S)-7,9,13-trimethyl-6,18-dioxo-5-oxatetracyclo[10.8.0.02,9.04,8]icos-13-en-16-yl] acetate.
| Compound Name | [(1R,2S,4S,7S,8R,9S,12S,13E,16S)-7,9,13-trimethyl-6,18-dioxo-5-oxatetracyclo[10.8.0.02,9.04,8]icos-13-en-16-yl] acetate |
|---|---|
| PubChem CID | 166440994 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1R,2S,4S,7S,8R,9S,12S,13E,16S)-7,9,13-trimethyl-6,18-dioxo-5-oxatetracyclo[10.8.0.02,9.04,8]icos-13-en-16-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C=C(\C)[C@H]2CC[C@]3(C)[C@@H]4[C@H](C[C@H]3[C@@H]2CCC(=O)C1)OC(=O)[C@H]4C |
| InChI | InChI=1S/C24H34O5/c1-13-5-7-17(28-15(3)25)11-16(26)6-8-19-18(13)9-10-24(4)20(19)12-21-22(24)14(2)23(27)29-21/h5,14,17-22H,6-12H2,1-4H3/b13-5+/t14-,17-,18+,19+,20-,21-,22-,24-/m0/s1 |
| InChIKey | NIBFQCWDDICKGC-SOZOVQFDSA-N |
| XLogP | 4.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|