C24H32O4 — CID 166440996
[(1R,2S,4S,7S,8R,9S,12S,14R,16S)-7,9-dimethyl-13-methylidene-6-oxo-5-oxapentacyclo[10.8.0.02,9.04,8.014,18]icos-18-en-16-yl] acetate (PubChem CID 166440996) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(1R,2S,4S,7S,8R,9S,12S,14R,16S)-7,9-dimethyl-13-methylidene-6-oxo-5-oxapentacyclo[10.8.0.02,9.04,8.014,18]icos-18-en-16-yl] acetate.
| Compound Name | [(1R,2S,4S,7S,8R,9S,12S,14R,16S)-7,9-dimethyl-13-methylidene-6-oxo-5-oxapentacyclo[10.8.0.02,9.04,8.014,18]icos-18-en-16-yl] acetate |
|---|---|
| PubChem CID | 166440996 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(1R,2S,4S,7S,8R,9S,12S,14R,16S)-7,9-dimethyl-13-methylidene-6-oxo-5-oxapentacyclo[10.8.0.02,9.04,8.014,18]icos-18-en-16-yl] acetate |
| SMILES | C=C1[C@@H]2C[C@H](OC(C)=O)CC2=CC[C@@H]2[C@@H]1CC[C@]1(C)[C@@H]3[C@H](C[C@@H]21)OC(=O)[C@H]3C |
| InChI | InChI=1S/C24H32O4/c1-12-17-7-8-24(4)20(11-21-22(24)13(2)23(26)28-21)18(17)6-5-15-9-16(10-19(12)15)27-14(3)25/h5,13,16-22H,1,6-11H2,2-4H3/t13-,16+,17+,18+,19-,20-,21-,22-,24-/m0/s1 |
| InChIKey | WPXBRAYSFOCLEQ-OEKFPTNQSA-N |
| XLogP | 4.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|