C10H14N2O — CID 166441259
(1S,6S)-6-amino-N-prop-2-ynylcyclohex-3-ene-1-carboxamide (PubChem CID 166441259) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (1S,6S)-6-amino-N-prop-2-ynylcyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6S)-6-amino-N-prop-2-ynylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 166441259 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (1S,6S)-6-amino-N-prop-2-ynylcyclohex-3-ene-1-carboxamide |
| SMILES | C#CCNC(=O)[C@H]1CC=CC[C@@H]1N |
| InChI | InChI=1S/C10H14N2O/c1-2-7-12-10(13)8-5-3-4-6-9(8)11/h1,3-4,8-9H,5-7,11H2,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | NEDICQSSTIUGAA-IUCAKERBSA-N |
| XLogP | 0.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|