C28H23NO4 — CID 166441296
1'-[4-methyl-2-(2-phenylpropan-2-yl)phenyl]spiro[indene-2,3'-pyrrolidine]-1,2',3,5'-tetrone (PubChem CID 166441296) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1'-[4-methyl-2-(2-phenylpropan-2-yl)phenyl]spiro[indene-2,3'-pyrrolidine]-1,2',3,5'-tetrone.
| Compound Name | 1'-[4-methyl-2-(2-phenylpropan-2-yl)phenyl]spiro[indene-2,3'-pyrrolidine]-1,2',3,5'-tetrone |
|---|---|
| PubChem CID | 166441296 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1'-[4-methyl-2-(2-phenylpropan-2-yl)phenyl]spiro[indene-2,3'-pyrrolidine]-1,2',3,5'-tetrone |
| SMILES | Cc1ccc(N2C(=O)CC3(C(=O)c4ccccc4C3=O)C2=O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C28H23NO4/c1-17-13-14-22(21(15-17)27(2,3)18-9-5-4-6-10-18)29-23(30)16-28(26(29)33)24(31)19-11-7-8-12-20(19)25(28)32/h4-15H,16H2,1-3H3 |
| InChIKey | XSYQDEQTUJBNRM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|