C18H14N2OS2 — CID 166442263
3-(1,3-benzothiazol-2-ylsulfanyl)-1-ethylquinolin-4-one (PubChem CID 166442263) has the molecular formula C18H14N2OS2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-1-ethylquinolin-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-1-ethylquinolin-4-one |
|---|---|
| PubChem CID | 166442263 |
| Molecular Formula | C18H14N2OS2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-1-ethylquinolin-4-one |
| SMILES | CCn1cc(Sc2nc3ccccc3s2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C18H14N2OS2/c1-2-20-11-16(17(21)12-7-3-5-9-14(12)20)23-18-19-13-8-4-6-10-15(13)22-18/h3-11H,2H2,1H3 |
| InChIKey | LJQOVXIKFLHOBR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |