C28H23BrN2O2 — CID 166442551
4-[(2S)-2-(4-bromophenyl)but-3-enyl]-1-[(4-methoxyphenyl)methyl]-2-oxoquinoline-3-carbonitrile (PubChem CID 166442551) has the molecular formula C28H23BrN2O2 and a molecular weight of 499.41 g/mol. Its IUPAC name is 4-[(2S)-2-(4-bromophenyl)but-3-enyl]-1-[(4-methoxyphenyl)methyl]-2-oxoquinoline-3-carbonitrile.
| Compound Name | 4-[(2S)-2-(4-bromophenyl)but-3-enyl]-1-[(4-methoxyphenyl)methyl]-2-oxoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 166442551 |
| Molecular Formula | C28H23BrN2O2 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 4-[(2S)-2-(4-bromophenyl)but-3-enyl]-1-[(4-methoxyphenyl)methyl]-2-oxoquinoline-3-carbonitrile |
| SMILES | C=C[C@H](Cc1c(C#N)c(=O)n(Cc2ccc(OC)cc2)c2ccccc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H23BrN2O2/c1-3-20(21-10-12-22(29)13-11-21)16-25-24-6-4-5-7-27(24)31(28(32)26(25)17-30)18-19-8-14-23(33-2)15-9-19/h3-15,20H,1,16,18H2,2H3/t20-/m1/s1 |
| InChIKey | IUAZXUUDBBBART-HXUWFJFHSA-N |
| XLogP | 6.20 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|