C31H30N2O2 — CID 166439006
1-[(4-methoxyphenyl)methyl]-2-oxo-4-[(2S)-2-(4-propan-2-ylphenyl)but-3-enyl]quinoline-3-carbonitrile (PubChem CID 166439006) has the molecular formula C31H30N2O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2-oxo-4-[(2S)-2-(4-propan-2-ylphenyl)but-3-enyl]quinoline-3-carbonitrile.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2-oxo-4-[(2S)-2-(4-propan-2-ylphenyl)but-3-enyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 166439006 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2-oxo-4-[(2S)-2-(4-propan-2-ylphenyl)but-3-enyl]quinoline-3-carbonitrile |
| SMILES | C=C[C@H](Cc1c(C#N)c(=O)n(Cc2ccc(OC)cc2)c2ccccc12)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H30N2O2/c1-5-23(25-14-12-24(13-15-25)21(2)3)18-28-27-8-6-7-9-30(27)33(31(34)29(28)19-32)20-22-10-16-26(35-4)17-11-22/h5-17,21,23H,1,18,20H2,2-4H3/t23-/m1/s1 |
| InChIKey | WRRSBAYDZUJSOL-HSZRJFAPSA-N |
| XLogP | 6.57 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|