C24H30NO4P — CID 102470233
1-dimethoxyphosphoryl-3-[2-(4-methoxyphenyl)but-3-enyl]-2-propylisoindole (PubChem CID 102470233) has the molecular formula C24H30NO4P and a molecular weight of 427.48 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-3-[2-(4-methoxyphenyl)but-3-enyl]-2-propylisoindole.
| Compound Name | 1-dimethoxyphosphoryl-3-[2-(4-methoxyphenyl)but-3-enyl]-2-propylisoindole |
|---|---|
| PubChem CID | 102470233 |
| Molecular Formula | C24H30NO4P |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-dimethoxyphosphoryl-3-[2-(4-methoxyphenyl)but-3-enyl]-2-propylisoindole |
| SMILES | C=CC(Cc1c2ccccc2c(P(=O)(OC)OC)n1CCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30NO4P/c1-6-16-25-23(17-18(7-2)19-12-14-20(27-3)15-13-19)21-10-8-9-11-22(21)24(25)30(26,28-4)29-5/h7-15,18H,2,6,16-17H2,1,3-5H3 |
| InChIKey | JTSKTPRGKJXITP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|