C26H29O2P — CID 102492857
1-[(Z)-1-diphenylphosphorylhept-2-en-4-yl]-4-methoxybenzene (PubChem CID 102492857) has the molecular formula C26H29O2P and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[(Z)-1-diphenylphosphorylhept-2-en-4-yl]-4-methoxybenzene.
| Compound Name | 1-[(Z)-1-diphenylphosphorylhept-2-en-4-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 102492857 |
| Molecular Formula | C26H29O2P |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[(Z)-1-diphenylphosphorylhept-2-en-4-yl]-4-methoxybenzene |
| SMILES | CCCC(/C=C\CP(=O)(c1ccccc1)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H29O2P/c1-3-11-22(23-17-19-24(28-2)20-18-23)12-10-21-29(27,25-13-6-4-7-14-25)26-15-8-5-9-16-26/h4-10,12-20,22H,3,11,21H2,1-2H3/b12-10- |
| InChIKey | GQULJUNJWOYWNJ-BENRWUELSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|