C32H35O3P — CID 90776006
3-methoxy-3-(4-methoxyphenyl)-2,2-dimethylpropanal;methylidene(triphenyl)-λ5-phosphane (PubChem CID 90776006) has the molecular formula C32H35O3P and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-methoxy-3-(4-methoxyphenyl)-2,2-dimethylpropanal;methylidene(triphenyl)-λ5-phosphane.
| Compound Name | 3-methoxy-3-(4-methoxyphenyl)-2,2-dimethylpropanal;methylidene(triphenyl)-λ5-phosphane |
|---|---|
| PubChem CID | 90776006 |
| Molecular Formula | C32H35O3P |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-methoxy-3-(4-methoxyphenyl)-2,2-dimethylpropanal;methylidene(triphenyl)-λ5-phosphane |
| SMILES | C=P(c1ccccc1)(c1ccccc1)c1ccccc1.COc1ccc(C(OC)C(C)(C)C=O)cc1 |
| InChI | InChI=1S/C19H17P.C13H18O3/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-13(2,9-14)12(16-4)10-5-7-11(15-3)8-6-10/h2-16H,1H2;5-9,12H,1-4H3 |
| InChIKey | DUMIQLNGNRIGDD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|