C17H24O4 — CID 68621070
ethyl 5-methoxy-5-(4-methoxyphenyl)-4,4-dimethylpent-2-enoate (PubChem CID 68621070) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 5-methoxy-5-(4-methoxyphenyl)-4,4-dimethylpent-2-enoate.
| Compound Name | ethyl 5-methoxy-5-(4-methoxyphenyl)-4,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 68621070 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl 5-methoxy-5-(4-methoxyphenyl)-4,4-dimethylpent-2-enoate |
| SMILES | CCOC(=O)C=CC(C)(C)C(OC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H24O4/c1-6-21-15(18)11-12-17(2,3)16(20-5)13-7-9-14(19-4)10-8-13/h7-12,16H,6H2,1-5H3 |
| InChIKey | YSOHXNGXRNHMFP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|