C17H18FNO3S — CID 166443335
N-[3-(4-fluorophenyl)-3-oxopropyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 166443335) has the molecular formula C17H18FNO3S and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-3-oxopropyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(4-fluorophenyl)-3-oxopropyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 166443335 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[3-(4-fluorophenyl)-3-oxopropyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H18FNO3S/c1-13-3-9-16(10-4-13)23(21,22)19(2)12-11-17(20)14-5-7-15(18)8-6-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | HHPSTLCSHMPIAZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |