C10H7BrF6 — CID 166443349
1-bromo-3-(1,1,1,4,4,4-hexafluorobutan-2-yl)benzene (PubChem CID 166443349) has the molecular formula C10H7BrF6 and a molecular weight of 321.06 g/mol. Its IUPAC name is 1-bromo-3-(1,1,1,4,4,4-hexafluorobutan-2-yl)benzene.
| Compound Name | 1-bromo-3-(1,1,1,4,4,4-hexafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 166443349 |
| Molecular Formula | C10H7BrF6 |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 1-bromo-3-(1,1,1,4,4,4-hexafluorobutan-2-yl)benzene |
| SMILES | FC(F)(F)CC(c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C10H7BrF6/c11-7-3-1-2-6(4-7)8(10(15,16)17)5-9(12,13)14/h1-4,8H,5H2 |
| InChIKey | UARQXXFIXZNCLG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |