C26H24F3NO2 — CID 166444882
2,2,2-trifluoroethyl 2-(N-benzylanilino)-2-phenylpent-4-enoate (PubChem CID 166444882) has the molecular formula C26H24F3NO2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(N-benzylanilino)-2-phenylpent-4-enoate.
| Compound Name | 2,2,2-trifluoroethyl 2-(N-benzylanilino)-2-phenylpent-4-enoate |
|---|---|
| PubChem CID | 166444882 |
| Molecular Formula | C26H24F3NO2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(N-benzylanilino)-2-phenylpent-4-enoate |
| SMILES | C=CCC(C(=O)OCC(F)(F)F)(c1ccccc1)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24F3NO2/c1-2-18-25(22-14-8-4-9-15-22,24(31)32-20-26(27,28)29)30(23-16-10-5-11-17-23)19-21-12-6-3-7-13-21/h2-17H,1,18-20H2 |
| InChIKey | AFXNZYUXLIEYJT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|