C26H22O5 — CID 166445617
benzyl 2-[(1R,2S,3S)-2-benzoyl-3-(4-methoxyphenyl)cyclopropyl]-2-oxoacetate (PubChem CID 166445617) has the molecular formula C26H22O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is benzyl 2-[(1R,2S,3S)-2-benzoyl-3-(4-methoxyphenyl)cyclopropyl]-2-oxoacetate.
| Compound Name | benzyl 2-[(1R,2S,3S)-2-benzoyl-3-(4-methoxyphenyl)cyclopropyl]-2-oxoacetate |
|---|---|
| PubChem CID | 166445617 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | benzyl 2-[(1R,2S,3S)-2-benzoyl-3-(4-methoxyphenyl)cyclopropyl]-2-oxoacetate |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)c3ccccc3)[C@@H]2C(=O)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H22O5/c1-30-20-14-12-18(13-15-20)21-22(24(27)19-10-6-3-7-11-19)23(21)25(28)26(29)31-16-17-8-4-2-5-9-17/h2-15,21-23H,16H2,1H3/t21-,22-,23+/m0/s1 |
| InChIKey | ZDUMKAAAIQHKTJ-RJGXRXQPSA-N |
| XLogP | 4.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|