C29H30O4 — CID 177413376
[(1S,2S,6S)-2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methoxymethyl]cyclohex-3-en-1-yl]-phenylmethanone (PubChem CID 177413376) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(1S,2S,6S)-2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methoxymethyl]cyclohex-3-en-1-yl]-phenylmethanone.
| Compound Name | [(1S,2S,6S)-2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methoxymethyl]cyclohex-3-en-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 177413376 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(1S,2S,6S)-2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methoxymethyl]cyclohex-3-en-1-yl]-phenylmethanone |
| SMILES | COc1ccc(COC[C@H]2CC=C[C@H](c3ccc(OC)cc3)[C@@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30O4/c1-31-25-15-11-21(12-16-25)19-33-20-24-9-6-10-27(22-13-17-26(32-2)18-14-22)28(24)29(30)23-7-4-3-5-8-23/h3-8,10-18,24,27-28H,9,19-20H2,1-2H3/t24-,27-,28-/m1/s1 |
| InChIKey | RHJBQHHJVSPDPU-RYRVMRHHSA-N |
| XLogP | 6.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|