C8H6ClN3Se — CID 166447281
5-(4-chlorophenyl)-1,3,4-selenadiazol-2-amine (PubChem CID 166447281) has the molecular formula C8H6ClN3Se and a molecular weight of 258.57 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1,3,4-selenadiazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)-1,3,4-selenadiazol-2-amine |
|---|---|
| PubChem CID | 166447281 |
| Molecular Formula | C8H6ClN3Se |
| Molecular Weight | 258.57 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 5-(4-chlorophenyl)-1,3,4-selenadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(Cl)cc2)[se]1 |
| InChI | InChI=1S/C8H6ClN3Se/c9-6-3-1-5(2-4-6)7-11-12-8(10)13-7/h1-4H,(H2,10,12) |
| InChIKey | FSJIVKLMSRRTSN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.57 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|