C21H19Cl2N — CID 166447795
[2,6-bis(2-chloro-4-methylphenyl)phenyl]methanamine (PubChem CID 166447795) has the molecular formula C21H19Cl2N and a molecular weight of 356.30 g/mol. Its IUPAC name is [2,6-bis(2-chloro-4-methylphenyl)phenyl]methanamine.
| Compound Name | [2,6-bis(2-chloro-4-methylphenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 166447795 |
| Molecular Formula | C21H19Cl2N |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [2,6-bis(2-chloro-4-methylphenyl)phenyl]methanamine |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(C)cc3Cl)c2CN)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N/c1-13-6-8-17(20(22)10-13)15-4-3-5-16(19(15)12-24)18-9-7-14(2)11-21(18)23/h3-11H,12,24H2,1-2H3 |
| InChIKey | UVVQDBVNDONYSU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |