C17H19NO3S — CID 166447841
(1S,4S,8S)-5-(4-methylphenyl)sulfonyl-5-azatricyclo[5.3.1.04,8]undec-9-en-2-one (PubChem CID 166447841) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is (1S,4S,8S)-5-(4-methylphenyl)sulfonyl-5-azatricyclo[5.3.1.04,8]undec-9-en-2-one.
| Compound Name | (1S,4S,8S)-5-(4-methylphenyl)sulfonyl-5-azatricyclo[5.3.1.04,8]undec-9-en-2-one |
|---|---|
| PubChem CID | 166447841 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (1S,4S,8S)-5-(4-methylphenyl)sulfonyl-5-azatricyclo[5.3.1.04,8]undec-9-en-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C[C@H]4C=C[C@@H]3[C@@H]2CC4=O)cc1 |
| InChI | InChI=1S/C17H19NO3S/c1-11-2-5-14(6-3-11)22(20,21)18-10-13-8-12-4-7-15(13)16(18)9-17(12)19/h2-7,12-13,15-16H,8-10H2,1H3/t12-,13?,15+,16+/m1/s1 |
| InChIKey | DCXNICBKZVKPHL-GEGQUWTFSA-N |
| XLogP | 2.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|