C19H21NO3S — CID 102478669
(1S,2S,6R,9S,10R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[8.2.1.02,6.02,9]tridec-11-en-3-one (PubChem CID 102478669) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (1S,2S,6R,9S,10R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[8.2.1.02,6.02,9]tridec-11-en-3-one.
| Compound Name | (1S,2S,6R,9S,10R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[8.2.1.02,6.02,9]tridec-11-en-3-one |
|---|---|
| PubChem CID | 102478669 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (1S,2S,6R,9S,10R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[8.2.1.02,6.02,9]tridec-11-en-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)[C@@]34[C@@H]5C=C[C@@H](C5)[C@@H]3CC[C@@H]24)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-12-2-6-15(7-3-12)24(22,23)20-11-18(21)19-14-5-4-13(10-14)16(19)8-9-17(19)20/h2-7,13-14,16-17H,8-11H2,1H3/t13-,14+,16-,17+,19-/m0/s1 |
| InChIKey | AFUADQWLJLTQSY-JLFGJHNZSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|