C21H29NO4S — CID 137288442
(3R,4R)-3a-methyl-3-(3-methylbutanoyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-4-carbaldehyde (PubChem CID 137288442) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is (3R,4R)-3a-methyl-3-(3-methylbutanoyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-4-carbaldehyde.
| Compound Name | (3R,4R)-3a-methyl-3-(3-methylbutanoyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-4-carbaldehyde |
|---|---|
| PubChem CID | 137288442 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (3R,4R)-3a-methyl-3-(3-methylbutanoyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-4-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3CC[C@@H](C=O)C3(C)[C@@H]2C(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C21H29NO4S/c1-14(2)11-19(24)20-21(4)16(7-8-17(21)13-23)12-22(20)27(25,26)18-9-5-15(3)6-10-18/h5-6,9-10,13-14,16-17,20H,7-8,11-12H2,1-4H3/t16?,17-,20-,21?/m0/s1 |
| InChIKey | NLVFZKAYVRJUOG-ZZWQXLNQSA-N |
| XLogP | 3.21 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|