C20H27NO3S — CID 132553161
(1S,6S,8R)-1,8-dimethyl-3-(4-methylphenyl)sulfonyl-6-prop-1-en-2-yl-3-azabicyclo[4.2.1]nonan-7-one (PubChem CID 132553161) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is (1S,6S,8R)-1,8-dimethyl-3-(4-methylphenyl)sulfonyl-6-prop-1-en-2-yl-3-azabicyclo[4.2.1]nonan-7-one.
| Compound Name | (1S,6S,8R)-1,8-dimethyl-3-(4-methylphenyl)sulfonyl-6-prop-1-en-2-yl-3-azabicyclo[4.2.1]nonan-7-one |
|---|---|
| PubChem CID | 132553161 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (1S,6S,8R)-1,8-dimethyl-3-(4-methylphenyl)sulfonyl-6-prop-1-en-2-yl-3-azabicyclo[4.2.1]nonan-7-one |
| SMILES | C=C(C)[C@@]12CCN(S(=O)(=O)c3ccc(C)cc3)C[C@@](C)(C1)[C@@H](C)C2=O |
| InChI | InChI=1S/C20H27NO3S/c1-14(2)20-10-11-21(13-19(5,12-20)16(4)18(20)22)25(23,24)17-8-6-15(3)7-9-17/h6-9,16H,1,10-13H2,2-5H3/t16-,19+,20+/m0/s1 |
| InChIKey | ZNTSVXOETQRLFJ-PWIZWCRZSA-N |
| XLogP | 3.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|