C17H21NO3S — CID 11404402
(1R,3S,5S,6R,10S)-5-methyl-8-(4-methylphenyl)sulfonyl-8-azatricyclo[4.3.1.03,10]decan-4-one (PubChem CID 11404402) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is (1R,3S,5S,6R,10S)-5-methyl-8-(4-methylphenyl)sulfonyl-8-azatricyclo[4.3.1.03,10]decan-4-one.
| Compound Name | (1R,3S,5S,6R,10S)-5-methyl-8-(4-methylphenyl)sulfonyl-8-azatricyclo[4.3.1.03,10]decan-4-one |
|---|---|
| PubChem CID | 11404402 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (1R,3S,5S,6R,10S)-5-methyl-8-(4-methylphenyl)sulfonyl-8-azatricyclo[4.3.1.03,10]decan-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3C[C@@H]4C(=O)[C@@H](C)[C@H](C2)[C@H]34)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-10-3-5-13(6-4-10)22(20,21)18-8-12-7-14-16(12)15(9-18)11(2)17(14)19/h3-6,11-12,14-16H,7-9H2,1-2H3/t11-,12-,14-,15-,16+/m0/s1 |
| InChIKey | BHGXJANFYAHBPO-YERCRUGSSA-N |
| XLogP | 2.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |