C19H25NO3S — CID 11256529
(5R,10R)-6-(4-methylphenyl)sulfonyl-10-prop-2-enyl-6-azaspiro[4.5]decan-4-one (PubChem CID 11256529) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is (5R,10R)-6-(4-methylphenyl)sulfonyl-10-prop-2-enyl-6-azaspiro[4.5]decan-4-one.
| Compound Name | (5R,10R)-6-(4-methylphenyl)sulfonyl-10-prop-2-enyl-6-azaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 11256529 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (5R,10R)-6-(4-methylphenyl)sulfonyl-10-prop-2-enyl-6-azaspiro[4.5]decan-4-one |
| SMILES | C=CC[C@H]1CCCN(S(=O)(=O)c2ccc(C)cc2)[C@]12CCCC2=O |
| InChI | InChI=1S/C19H25NO3S/c1-3-6-16-7-5-14-20(19(16)13-4-8-18(19)21)24(22,23)17-11-9-15(2)10-12-17/h3,9-12,16H,1,4-8,13-14H2,2H3/t16-,19+/m0/s1 |
| InChIKey | QVELETCJGQCRHO-QFBILLFUSA-N |
| XLogP | 3.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|