C23H28FNO3S — CID 58190449
1-[4-fluoro-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(4-propan-2-ylphenyl)ethanone (PubChem CID 58190449) has the molecular formula C23H28FNO3S and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[4-fluoro-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(4-propan-2-ylphenyl)ethanone.
| Compound Name | 1-[4-fluoro-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(4-propan-2-ylphenyl)ethanone |
|---|---|
| PubChem CID | 58190449 |
| Molecular Formula | C23H28FNO3S |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-[4-fluoro-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(4-propan-2-ylphenyl)ethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(F)(C(=O)Cc3ccc(C(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28FNO3S/c1-17(2)20-8-6-19(7-9-20)16-22(26)23(24)12-14-25(15-13-23)29(27,28)21-10-4-18(3)5-11-21/h4-11,17H,12-16H2,1-3H3 |
| InChIKey | AMIWQZMOUNFQON-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |