C18H21NO5S — CID 3839392
2-[1-(benzenesulfonyl)piperidine-4-carbonyl]cyclohexane-1,3-dione (PubChem CID 3839392) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)piperidine-4-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[1-(benzenesulfonyl)piperidine-4-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 3839392 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[1-(benzenesulfonyl)piperidine-4-carbonyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1C(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H21NO5S/c20-15-7-4-8-16(21)17(15)18(22)13-9-11-19(12-10-13)25(23,24)14-5-2-1-3-6-14/h1-3,5-6,13,17H,4,7-12H2 |
| InChIKey | GTLVHKWVDSYRET-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|