C17H21NO3S — CID 11472651
(4aR,7S,7aR)-7-methyl-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,4a,5,7,7a-hexahydrocyclopenta[c]pyridin-6-one (PubChem CID 11472651) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is (4aR,7S,7aR)-7-methyl-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,4a,5,7,7a-hexahydrocyclopenta[c]pyridin-6-one.
| Compound Name | (4aR,7S,7aR)-7-methyl-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,4a,5,7,7a-hexahydrocyclopenta[c]pyridin-6-one |
|---|---|
| PubChem CID | 11472651 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (4aR,7S,7aR)-7-methyl-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,4a,5,7,7a-hexahydrocyclopenta[c]pyridin-6-one |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)C[C@H]2[C@H](C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H21NO3S/c1-11-4-6-14(7-5-11)22(20,21)18-9-12(2)15-8-17(19)13(3)16(15)10-18/h4-7,13,15-16H,2,8-10H2,1,3H3/t13-,15-,16-/m0/s1 |
| InChIKey | GGINHUBZWAVLDW-BPUTZDHNSA-N |
| XLogP | 2.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|