C28H37F3N2O4S — CID 134955035
N-[(E,2R)-1-[(4aS,7aR)-2-(4-methylphenyl)sulfonyl-6-oxo-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-7a-yl]pent-3-en-2-yl]-2,2,2-trifluoro-N-hex-5-enylacetamide (PubChem CID 134955035) has the molecular formula C28H37F3N2O4S and a molecular weight of 554.68 g/mol. Its IUPAC name is N-[(E,2R)-1-[(4aS,7aR)-2-(4-methylphenyl)sulfonyl-6-oxo-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-7a-yl]pent-3-en-2-yl]-2,2,2-trifluoro-N-hex-5-enylacetamide.
| Compound Name | N-[(E,2R)-1-[(4aS,7aR)-2-(4-methylphenyl)sulfonyl-6-oxo-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-7a-yl]pent-3-en-2-yl]-2,2,2-trifluoro-N-hex-5-enylacetamide |
|---|---|
| PubChem CID | 134955035 |
| Molecular Formula | C28H37F3N2O4S |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | N-[(E,2R)-1-[(4aS,7aR)-2-(4-methylphenyl)sulfonyl-6-oxo-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-7a-yl]pent-3-en-2-yl]-2,2,2-trifluoro-N-hex-5-enylacetamide |
| SMILES | C=CCCCCN(C(=O)C(F)(F)F)[C@@H](/C=C/C)C[C@@]12CC(=O)C[C@@H]1CCN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C28H37F3N2O4S/c1-4-6-7-8-15-33(26(35)28(29,30)31)23(9-5-2)18-27-19-24(34)17-22(27)14-16-32(20-27)38(36,37)25-12-10-21(3)11-13-25/h4-5,9-13,22-23H,1,6-8,14-20H2,2-3H3/b9-5+/t22-,23-,27-/m0/s1 |
| InChIKey | FXZWQCBGUXYCBC-TZTVCMBKSA-N |
| XLogP | 5.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|