C17H23FN2O3S — CID 156602365
3-fluoro-N-methyl-N-[(1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]benzenesulfonamide (PubChem CID 156602365) has the molecular formula C17H23FN2O3S and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-[(1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-methyl-N-[(1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 156602365 |
| Molecular Formula | C17H23FN2O3S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-fluoro-N-methyl-N-[(1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]benzenesulfonamide |
| SMILES | CN1C(=O)CCC2(CN(C)S(=O)(=O)c3cccc(F)c3)CCCC12 |
| InChI | InChI=1S/C17H23FN2O3S/c1-19(24(22,23)14-6-3-5-13(18)11-14)12-17-9-4-7-15(17)20(2)16(21)8-10-17/h3,5-6,11,15H,4,7-10,12H2,1-2H3 |
| InChIKey | PXQKLYXHZTUMFS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |