C14H17FN2O3S — CID 10495308
(7R,8aR)-2-(4-fluorophenyl)sulfonyl-7-methyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 10495308) has the molecular formula C14H17FN2O3S and a molecular weight of 312.37 g/mol. Its IUPAC name is (7R,8aR)-2-(4-fluorophenyl)sulfonyl-7-methyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | (7R,8aR)-2-(4-fluorophenyl)sulfonyl-7-methyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 10495308 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (7R,8aR)-2-(4-fluorophenyl)sulfonyl-7-methyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | C[C@@H]1C[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)CCN2C1=O |
| InChI | InChI=1S/C14H17FN2O3S/c1-10-8-12-9-16(6-7-17(12)14(10)18)21(19,20)13-4-2-11(15)3-5-13/h2-5,10,12H,6-9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | HLCNGQUVATVPOP-ZYHUDNBSSA-N |
| XLogP | 1.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |