C23H32N2O3S — CID 134955034
(4aS,7aR)-7a-[[(6Z,8R)-1,2,3,4,5,8-hexahydroazocin-8-yl]methyl]-2-(4-methylphenyl)sulfonyl-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-6-one (PubChem CID 134955034) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is (4aS,7aR)-7a-[[(6Z,8R)-1,2,3,4,5,8-hexahydroazocin-8-yl]methyl]-2-(4-methylphenyl)sulfonyl-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-6-one.
| Compound Name | (4aS,7aR)-7a-[[(6Z,8R)-1,2,3,4,5,8-hexahydroazocin-8-yl]methyl]-2-(4-methylphenyl)sulfonyl-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-6-one |
|---|---|
| PubChem CID | 134955034 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (4aS,7aR)-7a-[[(6Z,8R)-1,2,3,4,5,8-hexahydroazocin-8-yl]methyl]-2-(4-methylphenyl)sulfonyl-1,3,4,4a,5,7-hexahydrocyclopenta[c]pyridin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3CC(=O)C[C@@]3(C[C@@H]3/C=C\CCCCN3)C2)cc1 |
| InChI | InChI=1S/C23H32N2O3S/c1-18-7-9-22(10-8-18)29(27,28)25-13-11-19-14-21(26)16-23(19,17-25)15-20-6-4-2-3-5-12-24-20/h4,6-10,19-20,24H,2-3,5,11-17H2,1H3/b6-4-/t19-,20-,23-/m0/s1 |
| InChIKey | HHDRQYMMEJWMOJ-VNGBIPGFSA-N |
| XLogP | 3.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|