C21H27NO3S — CID 10883251
N-[(1S,2R,7S,8R)-2,6-dimethyl-9-oxo-7-tricyclo[6.3.1.01,5]dodec-5-enyl]-4-methylbenzenesulfonamide (PubChem CID 10883251) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[(1S,2R,7S,8R)-2,6-dimethyl-9-oxo-7-tricyclo[6.3.1.01,5]dodec-5-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R,7S,8R)-2,6-dimethyl-9-oxo-7-tricyclo[6.3.1.01,5]dodec-5-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10883251 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[(1S,2R,7S,8R)-2,6-dimethyl-9-oxo-7-tricyclo[6.3.1.01,5]dodec-5-enyl]-4-methylbenzenesulfonamide |
| SMILES | CC1=C2CC[C@@H](C)[C@@]23CCC(=O)[C@H](C3)[C@@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-13-4-7-16(8-5-13)26(24,25)22-20-15(3)18-9-6-14(2)21(18)11-10-19(23)17(20)12-21/h4-5,7-8,14,17,20,22H,6,9-12H2,1-3H3/t14-,17+,20-,21+/m1/s1 |
| InChIKey | HLYPHHDKBKSWPH-GCVJAVPDSA-N |
| XLogP | 3.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|