C22H29NO3S — CID 6636276
N-(6,6-dimethyl-5-oxo-1-phenylheptan-3-yl)-4-methylbenzenesulfonamide (PubChem CID 6636276) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-(6,6-dimethyl-5-oxo-1-phenylheptan-3-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(6,6-dimethyl-5-oxo-1-phenylheptan-3-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6636276 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(6,6-dimethyl-5-oxo-1-phenylheptan-3-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCc2ccccc2)CC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-17-10-14-20(15-11-17)27(25,26)23-19(16-21(24)22(2,3)4)13-12-18-8-6-5-7-9-18/h5-11,14-15,19,23H,12-13,16H2,1-4H3 |
| InChIKey | KRRAOBCOGQCLCS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |