C19H19NO3S — CID 101129278
4-methyl-N-[(5-oxocyclopenten-1-yl)-phenylmethyl]benzenesulfonamide (PubChem CID 101129278) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-methyl-N-[(5-oxocyclopenten-1-yl)-phenylmethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(5-oxocyclopenten-1-yl)-phenylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101129278 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-methyl-N-[(5-oxocyclopenten-1-yl)-phenylmethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C2=CCCC2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO3S/c1-14-10-12-16(13-11-14)24(22,23)20-19(15-6-3-2-4-7-15)17-8-5-9-18(17)21/h2-4,6-8,10-13,19-20H,5,9H2,1H3 |
| InChIKey | PNBMZCGKPIKUIC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |