C18H23NO3S — CID 10065429
(3aS,5aR,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-1H-cyclopenta[c]indol-2-one (PubChem CID 10065429) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (3aS,5aR,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-1H-cyclopenta[c]indol-2-one.
| Compound Name | (3aS,5aR,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-1H-cyclopenta[c]indol-2-one |
|---|---|
| PubChem CID | 10065429 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (3aS,5aR,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-1H-cyclopenta[c]indol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3CC(=O)C[C@@]34CCCC[C@@H]24)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-13-5-7-16(8-6-13)23(21,22)19-12-14-10-15(20)11-18(14)9-3-2-4-17(18)19/h5-8,14,17H,2-4,9-12H2,1H3/t14-,17-,18+/m1/s1 |
| InChIKey | HCPUOVVRUXRLOF-OLMNPRSZSA-N |
| XLogP | 2.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |