C20H23NO3S — CID 139190316
(1S,2S,6R,10S,11R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[9.2.1.02,6.02,10]tetradec-12-en-3-one (PubChem CID 139190316) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (1S,2S,6R,10S,11R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[9.2.1.02,6.02,10]tetradec-12-en-3-one.
| Compound Name | (1S,2S,6R,10S,11R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[9.2.1.02,6.02,10]tetradec-12-en-3-one |
|---|---|
| PubChem CID | 139190316 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (1S,2S,6R,10S,11R)-5-(4-methylphenyl)sulfonyl-5-azatetracyclo[9.2.1.02,6.02,10]tetradec-12-en-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)[C@@]34[C@@H]5C=C[C@@H](C5)[C@@H]3CCC[C@@H]24)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-13-5-9-16(10-6-13)25(23,24)21-12-19(22)20-15-8-7-14(11-15)17(20)3-2-4-18(20)21/h5-10,14-15,17-18H,2-4,11-12H2,1H3/t14-,15+,17-,18+,20-/m0/s1 |
| InChIKey | VFWCDHFVYBLIRU-HOXSDCPRSA-N |
| XLogP | 2.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|