C23H31NO3S — CID 134833190
1-(2-bicyclo[2.2.1]hept-5-enyl)-2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]ethanone (PubChem CID 134833190) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 134833190 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CC(=O)C3CC4C=CC3C4)CC[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C23H31NO3S/c1-15(2)22-11-8-19(14-23(25)21-13-17-6-7-18(21)12-17)24(22)28(26,27)20-9-4-16(3)5-10-20/h4-7,9-10,15,17-19,21-22H,8,11-14H2,1-3H3/t17?,18?,19-,21?,22+/m0/s1 |
| InChIKey | RUUGMGFWTGYALU-GOKCANLMSA-N |
| XLogP | 4.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|