C18H21NO3S — CID 74370953
11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one (PubChem CID 74370953) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one.
| Compound Name | 11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one |
|---|---|
| PubChem CID | 74370953 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one |
| SMILES | CC1=CC23CN(S(=O)(=O)c4ccc(C)cc4)CC2CC1CC3=O |
| InChI | InChI=1S/C18H21NO3S/c1-12-3-5-16(6-4-12)23(21,22)19-10-15-7-14-8-17(20)18(15,11-19)9-13(14)2/h3-6,9,14-15H,7-8,10-11H2,1-2H3 |
| InChIKey | AHVCIERWBIBFLC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|