C19H23NO4S — CID 135013194
8-(hydroxymethyl)-11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one (PubChem CID 135013194) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 8-(hydroxymethyl)-11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one.
| Compound Name | 8-(hydroxymethyl)-11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one |
|---|---|
| PubChem CID | 135013194 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 8-(hydroxymethyl)-11-methyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one |
| SMILES | CC1=CC23CN(S(=O)(=O)c4ccc(C)cc4)CC2CC1C(CO)C3=O |
| InChI | InChI=1S/C19H23NO4S/c1-12-3-5-15(6-4-12)25(23,24)20-9-14-7-16-13(2)8-19(14,11-20)18(22)17(16)10-21/h3-6,8,14,16-17,21H,7,9-11H2,1-2H3 |
| InChIKey | LXQDEUJHKFBEEB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|