C19H23NO3S — CID 135013196
8,11-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one (PubChem CID 135013196) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 8,11-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one.
| Compound Name | 8,11-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one |
|---|---|
| PubChem CID | 135013196 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 8,11-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatricyclo[5.2.2.01,5]undec-10-en-9-one |
| SMILES | CC1=CC23CN(S(=O)(=O)c4ccc(C)cc4)CC2CC1C(C)C3=O |
| InChI | InChI=1S/C19H23NO3S/c1-12-4-6-16(7-5-12)24(22,23)20-10-15-8-17-13(2)9-19(15,11-20)18(21)14(17)3/h4-7,9,14-15,17H,8,10-11H2,1-3H3 |
| InChIKey | PQIWOZHLTRNKMH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|