C25H29NO3S — CID 138980378
(3R,3aR,7S,7aR)-7,7a-dimethyl-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)-2,3,3a,4,6,7-hexahydroindol-5-one (PubChem CID 138980378) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is (3R,3aR,7S,7aR)-7,7a-dimethyl-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)-2,3,3a,4,6,7-hexahydroindol-5-one.
| Compound Name | (3R,3aR,7S,7aR)-7,7a-dimethyl-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)-2,3,3a,4,6,7-hexahydroindol-5-one |
|---|---|
| PubChem CID | 138980378 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (3R,3aR,7S,7aR)-7,7a-dimethyl-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)-2,3,3a,4,6,7-hexahydroindol-5-one |
| SMILES | C=C(c1ccccc1)[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@@]2(C)[C@@H]1CC(=O)C[C@@H]2C |
| InChI | InChI=1S/C25H29NO3S/c1-17-10-12-22(13-11-17)30(28,29)26-16-23(19(3)20-8-6-5-7-9-20)24-15-21(27)14-18(2)25(24,26)4/h5-13,18,23-24H,3,14-16H2,1-2,4H3/t18-,23-,24+,25+/m0/s1 |
| InChIKey | MFNGTIQEPAHZPC-URPHZZJISA-N |
| XLogP | 4.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |