C27H27NO3S — CID 46930114
[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-[(E)-3-phenylprop-1-enyl]pyrrolidin-3-yl]-phenylmethanone (PubChem CID 46930114) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is [(3S,4R)-1-(4-methylphenyl)sulfonyl-4-[(E)-3-phenylprop-1-enyl]pyrrolidin-3-yl]-phenylmethanone.
| Compound Name | [(3S,4R)-1-(4-methylphenyl)sulfonyl-4-[(E)-3-phenylprop-1-enyl]pyrrolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46930114 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(3S,4R)-1-(4-methylphenyl)sulfonyl-4-[(E)-3-phenylprop-1-enyl]pyrrolidin-3-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](/C=C/Cc3ccccc3)[C@H](C(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H27NO3S/c1-21-15-17-25(18-16-21)32(30,31)28-19-24(14-8-11-22-9-4-2-5-10-22)26(20-28)27(29)23-12-6-3-7-13-23/h2-10,12-18,24,26H,11,19-20H2,1H3/b14-8+/t24-,26+/m0/s1 |
| InChIKey | SISBRWJFEAIWMB-HNSNRUDVSA-N |
| XLogP | 4.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|