C26H31NO3S — CID 42627953
2-[(1S,2R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-phenylethanone (PubChem CID 42627953) has the molecular formula C26H31NO3S and a molecular weight of 437.61 g/mol. Its IUPAC name is 2-[(1S,2R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-phenylethanone.
| Compound Name | 2-[(1S,2R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 42627953 |
| Molecular Formula | C26H31NO3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[(1S,2R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-phenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3[C@@H](C)C2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO3S/c1-17-8-12-22(13-9-17)31(29,30)27-16-23-20-10-11-21(14-20)26(23)18(2)24(27)15-25(28)19-6-4-3-5-7-19/h3-9,12-13,18,20-21,23-24,26H,10-11,14-16H2,1-2H3/t18-,20-,21+,23+,24?,26-/m0/s1 |
| InChIKey | SNOAMEVYSAFJAC-FRJAXPLQSA-N |
| XLogP | 4.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |