C25H30N2O5S2 — CID 991357
2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]fluoren-9-one (PubChem CID 991357) has the molecular formula C25H30N2O5S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]fluoren-9-one.
| Compound Name | 2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]fluoren-9-one |
|---|---|
| PubChem CID | 991357 |
| Molecular Formula | C25H30N2O5S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]fluoren-9-one |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)c2cc(S(=O)(=O)N4CCC(C)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C25H30N2O5S2/c1-17-7-11-26(12-8-17)33(29,30)19-3-5-21-22-6-4-20(16-24(22)25(28)23(21)15-19)34(31,32)27-13-9-18(2)10-14-27/h3-6,15-18H,7-14H2,1-2H3 |
| InChIKey | FKQXGAXBQYVZAO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |