C21H22N2O5S2 — CID 979406
2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-one (PubChem CID 979406) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-one.
| Compound Name | 2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-one |
|---|---|
| PubChem CID | 979406 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-one |
| SMILES | O=C1c2cc(S(=O)(=O)N3CCCC3)ccc2-c2ccc(S(=O)(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C21H22N2O5S2/c24-21-19-13-15(29(25,26)22-9-1-2-10-22)5-7-17(19)18-8-6-16(14-20(18)21)30(27,28)23-11-3-4-12-23/h5-8,13-14H,1-4,9-12H2 |
| InChIKey | JHPHGYFNEYWXJU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |