C16H21NO3S — CID 102229455
(3S,3aR,7aS)-3-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7a-hexahydro-2H-indol-7-one (PubChem CID 102229455) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7a-hexahydro-2H-indol-7-one.
| Compound Name | (3S,3aR,7aS)-3-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7a-hexahydro-2H-indol-7-one |
|---|---|
| PubChem CID | 102229455 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3S,3aR,7aS)-3-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7a-hexahydro-2H-indol-7-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](C)[C@H]3CCCC(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C16H21NO3S/c1-11-6-8-13(9-7-11)21(19,20)17-10-12(2)14-4-3-5-15(18)16(14)17/h6-9,12,14,16H,3-5,10H2,1-2H3/t12-,14-,16+/m1/s1 |
| InChIKey | WABUCPAYUGKKOD-XPKDYRNWSA-N |
| XLogP | 2.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |